C37H35NO11 — CID 14682815
[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-(4-nitrophenoxy)-2-(trityloxymethyl)oxan-3-yl] acetate (PubChem CID 14682815) has the molecular formula C37H35NO11 and a molecular weight of 669.68 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-(4-nitrophenoxy)-2-(trityloxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-(4-nitrophenoxy)-2-(trityloxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 14682815 |
| Molecular Formula | C37H35NO11 |
| Molecular Weight | 669.68 g/mol |
| Exact Mass | 669.22 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-6-(4-nitrophenoxy)-2-(trityloxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](Oc2ccc([N+](=O)[O-])cc2)O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C37H35NO11/c1-24(39)45-33-32(23-44-37(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29)49-36(35(47-26(3)41)34(33)46-25(2)40)48-31-21-19-30(20-22-31)38(42)43/h4-22,32-36H,23H2,1-3H3/t32-,33-,34+,35-,36-/m1/s1 |
| InChIKey | JVGQFNWGESQEFT-SQGINLDNSA-N |
| XLogP | 5.50 |
| TPSA | 149.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.68 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|