C24H37NO9Si — CID 174063714
diethyl 2-[[(2R,3S,4R,5S,6R)-4,5-dimethyl-6-(4-nitrophenoxy)-3-trimethylsilyloxyoxan-2-yl]methyl]propanedioate (PubChem CID 174063714) has the molecular formula C24H37NO9Si and a molecular weight of 511.64 g/mol. Its IUPAC name is diethyl 2-[[(2R,3S,4R,5S,6R)-4,5-dimethyl-6-(4-nitrophenoxy)-3-trimethylsilyloxyoxan-2-yl]methyl]propanedioate.
| Compound Name | diethyl 2-[[(2R,3S,4R,5S,6R)-4,5-dimethyl-6-(4-nitrophenoxy)-3-trimethylsilyloxyoxan-2-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 174063714 |
| Molecular Formula | C24H37NO9Si |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | diethyl 2-[[(2R,3S,4R,5S,6R)-4,5-dimethyl-6-(4-nitrophenoxy)-3-trimethylsilyloxyoxan-2-yl]methyl]propanedioate |
| SMILES | CCOC(=O)C(C[C@H]1O[C@H](Oc2ccc([N+](=O)[O-])cc2)[C@@H](C)[C@@H](C)[C@@H]1O[Si](C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C24H37NO9Si/c1-8-30-22(26)19(23(27)31-9-2)14-20-21(34-35(5,6)7)15(3)16(4)24(33-20)32-18-12-10-17(11-13-18)25(28)29/h10-13,15-16,19-21,24H,8-9,14H2,1-7H3/t15-,16+,20-,21+,24+/m1/s1 |
| InChIKey | WEAZBSHTLRYAMY-BBMOCSSHSA-N |
| XLogP | 4.32 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|