C22H29F3O6Si — CID 163700236
7-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]oxy-4-(trifluoromethyl)chromen-2-one (PubChem CID 163700236) has the molecular formula C22H29F3O6Si and a molecular weight of 474.55 g/mol. Its IUPAC name is 7-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]oxy-4-(trifluoromethyl)chromen-2-one.
| Compound Name | 7-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]oxy-4-(trifluoromethyl)chromen-2-one |
|---|---|
| PubChem CID | 163700236 |
| Molecular Formula | C22H29F3O6Si |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 7-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]oxy-4-(trifluoromethyl)chromen-2-one |
| SMILES | CC1[C@@H](Oc2ccc3c(C(F)(F)F)cc(=O)oc3c2)O[C@H](CO)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H29F3O6Si/c1-12-19(31-32(5,6)21(2,3)4)17(11-26)30-20(12)28-13-7-8-14-15(22(23,24)25)10-18(27)29-16(14)9-13/h7-10,12,17,19-20,26H,11H2,1-6H3/t12?,17-,19+,20+/m1/s1 |
| InChIKey | RQGOXPGWHQZFQJ-VDUIHLFFSA-N |
| XLogP | 4.93 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|