About CID 131873728
CID 131873728 (PubChem CID 131873728) has the molecular formula C16H13F3KO9
and a molecular weight of 445.36 g/mol.
Molecular Properties
| Compound Name | CID 131873728 |
| PubChem CID | 131873728 |
| Molecular Formula | C16H13F3KO9 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | — |
| SMILES | O=C(O)[C@H]1O[C@@H](Oc2ccc3c(C(F)(F)F)cc(=O)oc3c2)[C@H](O)[C@@H](O)[C@@H]1O.[K] |
| InChI | InChI=1S/C16H13F3O9.K/c17-16(18,19)7-4-9(20)27-8-3-5(1-2-6(7)8)26-15-12(23)10(21)11(22)13(28-15)14(24)25;/h1-4,10-13,15,21-23H,(H,24,25);/t10-,11-,12+,13-,15+;/m0./s1 |
| InChIKey | WJDSTCFAMAOWDB-KSOKONAESA-N |
| XLogP | -0.30 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze CID 131873728 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131873728?
The IUPAC name of CID 131873728 (CID 131873728) is not available.
What is the SMILES notation for CID 131873728?
The canonical SMILES for CID 131873728 is O=C(O)[C@H]1O[C@@H](Oc2ccc3c(C(F)(F)F)cc(=O)oc3c2)[C@H](O)[C@@H](O)[C@@H]1O.[K].
What is the InChIKey of CID 131873728?
The InChIKey is WJDSTCFAMAOWDB-KSOKONAESA-N. The full InChI is InChI=1S/C16H13F3O9.K/c17-16(18,19)7-4-9(20)27-8-3-5(1-2-6(7)8)26-15-12(23)10(21)11(22)13(28-15)14(24)25;/h1-4,10-13,15,21-23H,(H,24,25);/t10-,11-,12+,13-,15+;/m0./s1.
What are the key properties of CID 131873728?
CID 131873728 has a molecular weight of 445.36 g/mol, XLogP of -0.30, 3 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131873728 is sourced from PubChem (CID 131873728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).