C16H13F3KO9 — CID 131873728
CID 131873728 (PubChem CID 131873728) has the molecular formula C16H13F3KO9 and a molecular weight of 445.36 g/mol.
| Compound Name | CID 131873728 |
|---|---|
| PubChem CID | 131873728 |
| Molecular Formula | C16H13F3KO9 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | — |
| SMILES | O=C(O)[C@H]1O[C@@H](Oc2ccc3c(C(F)(F)F)cc(=O)oc3c2)[C@H](O)[C@@H](O)[C@@H]1O.[K] |
| InChI | InChI=1S/C16H13F3O9.K/c17-16(18,19)7-4-9(20)27-8-3-5(1-2-6(7)8)26-15-12(23)10(21)11(22)13(28-15)14(24)25;/h1-4,10-13,15,21-23H,(H,24,25);/t10-,11-,12+,13-,15+;/m0./s1 |
| InChIKey | WJDSTCFAMAOWDB-KSOKONAESA-N |
| XLogP | -0.30 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|