C16H12F3O9- — CID 171320654
3,4,5-trihydroxy-6-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyoxane-2-carboxylate (PubChem CID 171320654) has the molecular formula C16H12F3O9- and a molecular weight of 405.26 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyoxane-2-carboxylate.
| Compound Name | 3,4,5-trihydroxy-6-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 171320654 |
| Molecular Formula | C16H12F3O9- |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 3,4,5-trihydroxy-6-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyoxane-2-carboxylate |
| SMILES | O=C([O-])C1OC(Oc2ccc3c(C(F)(F)F)cc(=O)oc3c2)C(O)C(O)C1O |
| InChI | InChI=1S/C16H13F3O9/c17-16(18,19)7-4-9(20)27-8-3-5(1-2-6(7)8)26-15-12(23)10(21)11(22)13(28-15)14(24)25/h1-4,10-13,15,21-23H,(H,24,25)/p-1 |
| InChIKey | MCDDIRXDQVYRLC-UHFFFAOYSA-M |
| XLogP | -1.25 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|