C25H22Na2O11 — CID 169442313
disodium;(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-oxido-2-oxo-3-(3-oxo-1-phenylbutyl)chromen-7-yl]oxyoxane-2-carboxylate (PubChem CID 169442313) has the molecular formula C25H22Na2O11 and a molecular weight of 544.42 g/mol. Its IUPAC name is disodium;(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-oxido-2-oxo-3-(3-oxo-1-phenylbutyl)chromen-7-yl]oxyoxane-2-carboxylate.
| Compound Name | disodium;(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-oxido-2-oxo-3-(3-oxo-1-phenylbutyl)chromen-7-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 169442313 |
| Molecular Formula | C25H22Na2O11 |
| Molecular Weight | 544.42 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | disodium;(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-oxido-2-oxo-3-(3-oxo-1-phenylbutyl)chromen-7-yl]oxyoxane-2-carboxylate |
| SMILES | CC(=O)CC(c1ccccc1)c1c([O-])c2ccc(O[C@@H]3O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]3O)cc2oc1=O.[Na+].[Na+] |
| InChI | InChI=1S/C25H24O11.2Na/c1-11(26)9-15(12-5-3-2-4-6-12)17-18(27)14-8-7-13(10-16(14)35-24(17)33)34-25-21(30)19(28)20(29)22(36-25)23(31)32;;/h2-8,10,15,19-22,25,27-30H,9H2,1H3,(H,31,32);;/q;2*+1/p-2/t15?,19-,20-,21+,22-,25+;;/m0../s1 |
| InChIKey | FJCYRGYFTAFFKV-ZDQGSSOSSA-L |
| XLogP | -7.08 |
| TPSA | 189.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.42 |
| LogP ≤ 5 | -7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|