C26H25NaO9 — CID 169438093
sodium (2S,3S,4S,5R,6S)-6-[3,5-bis(phenylmethoxy)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 169438093) has the molecular formula C26H25NaO9 and a molecular weight of 504.47 g/mol. Its IUPAC name is sodium (2S,3S,4S,5R,6S)-6-[3,5-bis(phenylmethoxy)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | sodium (2S,3S,4S,5R,6S)-6-[3,5-bis(phenylmethoxy)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 169438093 |
| Molecular Formula | C26H25NaO9 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | sodium (2S,3S,4S,5R,6S)-6-[3,5-bis(phenylmethoxy)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | O=C([O-])[C@H]1O[C@@H](Oc2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)[C@H](O)[C@@H](O)[C@@H]1O.[Na+] |
| InChI | InChI=1S/C26H26O9.Na/c27-21-22(28)24(25(30)31)35-26(23(21)29)34-20-12-18(32-14-16-7-3-1-4-8-16)11-19(13-20)33-15-17-9-5-2-6-10-17;/h1-13,21-24,26-29H,14-15H2,(H,30,31);/q;+1/p-1/t21-,22-,23+,24-,26+;/m0./s1 |
| InChIKey | KGIQPOMFYOXQJK-HEJOKCJASA-M |
| XLogP | -2.22 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |