C16H15NaO7 — CID 53398703
sodium 3,4,5-trihydroxy-6-naphthalen-1-yloxyoxane-2-carboxylate (PubChem CID 53398703) has the molecular formula C16H15NaO7 and a molecular weight of 342.28 g/mol. Its IUPAC name is sodium 3,4,5-trihydroxy-6-naphthalen-1-yloxyoxane-2-carboxylate.
| Compound Name | sodium 3,4,5-trihydroxy-6-naphthalen-1-yloxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 53398703 |
| Molecular Formula | C16H15NaO7 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | sodium 3,4,5-trihydroxy-6-naphthalen-1-yloxyoxane-2-carboxylate |
| SMILES | O=C([O-])C1OC(Oc2cccc3ccccc23)C(O)C(O)C1O.[Na+] |
| InChI | InChI=1S/C16H16O7.Na/c17-11-12(18)14(15(20)21)23-16(13(11)19)22-10-7-3-5-8-4-1-2-6-9(8)10;/h1-7,11-14,16-19H,(H,20,21);/q;+1/p-1 |
| InChIKey | NYYIXWAJCYTTOL-UHFFFAOYSA-M |
| XLogP | -4.22 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |