C17H18O6 — CID 142590210
5-naphthalen-1-yloxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3,6,7-triol (PubChem CID 142590210) has the molecular formula C17H18O6 and a molecular weight of 318.32 g/mol. Its IUPAC name is 5-naphthalen-1-yloxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3,6,7-triol.
| Compound Name | 5-naphthalen-1-yloxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3,6,7-triol |
|---|---|
| PubChem CID | 142590210 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 5-naphthalen-1-yloxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3,6,7-triol |
| SMILES | OC1COC2C(O)C(O)C(Oc3cccc4ccccc34)OC12 |
| InChI | InChI=1S/C17H18O6/c18-11-8-21-16-13(19)14(20)17(23-15(11)16)22-12-7-3-5-9-4-1-2-6-10(9)12/h1-7,11,13-20H,8H2 |
| InChIKey | GUNDYGNMZBOGPV-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |