C17H19NO9S — CID 5271709
[(2R,3S,4R,5R,6R)-5-acetamido-3,4-dihydroxy-6-naphthalen-1-yloxyoxan-2-yl] hydrogen sulfate (PubChem CID 5271709) has the molecular formula C17H19NO9S and a molecular weight of 413.40 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-acetamido-3,4-dihydroxy-6-naphthalen-1-yloxyoxan-2-yl] hydrogen sulfate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-dihydroxy-6-naphthalen-1-yloxyoxan-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 5271709 |
| Molecular Formula | C17H19NO9S |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-dihydroxy-6-naphthalen-1-yloxyoxan-2-yl] hydrogen sulfate |
| SMILES | CC(=O)N[C@H]1[C@H](Oc2cccc3ccccc23)O[C@H](OS(=O)(=O)O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H19NO9S/c1-9(19)18-13-14(20)15(21)17(27-28(22,23)24)26-16(13)25-12-8-4-6-10-5-2-3-7-11(10)12/h2-8,13-17,20-21H,1H3,(H,18,19)(H,22,23,24)/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | UKAHKHIQNFBNEC-NQNKBUKLSA-N |
| XLogP | -0.05 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|