C16H15O8- — CID 140742773
3,4,5-trihydroxy-6-(3-hydroxynaphthalen-2-yl)oxyoxane-2-carboxylate (PubChem CID 140742773) has the molecular formula C16H15O8- and a molecular weight of 335.29 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-(3-hydroxynaphthalen-2-yl)oxyoxane-2-carboxylate.
| Compound Name | 3,4,5-trihydroxy-6-(3-hydroxynaphthalen-2-yl)oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 140742773 |
| Molecular Formula | C16H15O8- |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 3,4,5-trihydroxy-6-(3-hydroxynaphthalen-2-yl)oxyoxane-2-carboxylate |
| SMILES | O=C([O-])C1OC(Oc2cc3ccccc3cc2O)C(O)C(O)C1O |
| InChI | InChI=1S/C16H16O8/c17-9-5-7-3-1-2-4-8(7)6-10(9)23-16-13(20)11(18)12(19)14(24-16)15(21)22/h1-6,11-14,16-20H,(H,21,22)/p-1 |
| InChIKey | VLXRDQMCROTAQJ-UHFFFAOYSA-M |
| XLogP | -1.52 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |