C21H16Na2O14S — CID 171381053
disodium;(2S,3S,4S,5R)-3,4,5-trihydroxy-6-[5-hydroxy-4-oxo-3-(2-sulfonatooxyphenyl)chromen-6-yl]oxyoxane-2-carboxylate (PubChem CID 171381053) has the molecular formula C21H16Na2O14S and a molecular weight of 570.39 g/mol. Its IUPAC name is disodium;(2S,3S,4S,5R)-3,4,5-trihydroxy-6-[5-hydroxy-4-oxo-3-(2-sulfonatooxyphenyl)chromen-6-yl]oxyoxane-2-carboxylate.
| Compound Name | disodium;(2S,3S,4S,5R)-3,4,5-trihydroxy-6-[5-hydroxy-4-oxo-3-(2-sulfonatooxyphenyl)chromen-6-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 171381053 |
| Molecular Formula | C21H16Na2O14S |
| Molecular Weight | 570.39 g/mol |
| Exact Mass | 570.01 |
| IUPAC Name | disodium;(2S,3S,4S,5R)-3,4,5-trihydroxy-6-[5-hydroxy-4-oxo-3-(2-sulfonatooxyphenyl)chromen-6-yl]oxyoxane-2-carboxylate |
| SMILES | O=C([O-])[C@H]1OC(Oc2ccc3occ(-c4ccccc4OS(=O)(=O)[O-])c(=O)c3c2O)[C@H](O)[C@@H](O)[C@@H]1O.[Na+].[Na+] |
| InChI | InChI=1S/C21H18O14S.2Na/c22-14-9(8-3-1-2-4-10(8)35-36(29,30)31)7-32-11-5-6-12(15(23)13(11)14)33-21-18(26)16(24)17(25)19(34-21)20(27)28;;/h1-7,16-19,21,23-26H,(H,27,28)(H,29,30,31);;/q;2*+1/p-2/t16-,17-,18+,19-,21?;;/m0../s1 |
| InChIKey | OKPZHVBGDNPGTB-JYMMHJRRSA-L |
| XLogP | -8.05 |
| TPSA | 236.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.39 |
| LogP ≤ 5 | -8.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|