C23H29NO8 — CID 125121343
(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-[3-methyl-4-[(1S)-3-(methylamino)-1-phenylpropoxy]phenoxy]oxane-2-carboxylic acid (PubChem CID 125121343) has the molecular formula C23H29NO8 and a molecular weight of 447.48 g/mol. Its IUPAC name is (2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-[3-methyl-4-[(1S)-3-(methylamino)-1-phenylpropoxy]phenoxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-[3-methyl-4-[(1S)-3-(methylamino)-1-phenylpropoxy]phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 125121343 |
| Molecular Formula | C23H29NO8 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | (2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-[3-methyl-4-[(1S)-3-(methylamino)-1-phenylpropoxy]phenoxy]oxane-2-carboxylic acid |
| SMILES | CNCC[C@H](Oc1ccc(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@@H](O)[C@@H]2O)cc1C)c1ccccc1 |
| InChI | InChI=1S/C23H29NO8/c1-13-12-15(30-23-20(27)18(25)19(26)21(32-23)22(28)29)8-9-16(13)31-17(10-11-24-2)14-6-4-3-5-7-14/h3-9,12,17-21,23-27H,10-11H2,1-2H3,(H,28,29)/t17-,18+,19-,20-,21-,23+/m0/s1 |
| InChIKey | DJWNPJFKTPNTAE-IKHCIZMXSA-N |
| XLogP | 1.00 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |