C22H30F3O9PSi — CID 163957073
[(2R,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 163957073) has the molecular formula C22H30F3O9PSi and a molecular weight of 554.53 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 163957073 |
| Molecular Formula | C22H30F3O9PSi |
| Molecular Weight | 554.53 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | [(2R,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-[2-oxo-4-(trifluoromethyl)chromen-7-yl]oxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | C[C@H]1[C@@H](Oc2ccc3c(C(F)(F)F)cc(=O)oc3c2)O[C@H](COP(=O)(O)O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H30F3O9PSi/c1-12-19(34-36(5,6)21(2,3)4)17(11-30-35(27,28)29)33-20(12)31-13-7-8-14-15(22(23,24)25)10-18(26)32-16(14)9-13/h7-10,12,17,19-20H,11H2,1-6H3,(H2,27,28,29)/t12-,17-,19+,20+/m1/s1 |
| InChIKey | ZGXXEUGEEJMKEN-GISJFGRKSA-N |
| XLogP | 5.05 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|