C18H16N2O8 — CID 87874185
3-methyl-2-(4-nitrophenoxy)-2-[[3-(4-nitrophenoxy)oxiran-2-yl]methyl]oxirane (PubChem CID 87874185) has the molecular formula C18H16N2O8 and a molecular weight of 388.33 g/mol. Its IUPAC name is 3-methyl-2-(4-nitrophenoxy)-2-[[3-(4-nitrophenoxy)oxiran-2-yl]methyl]oxirane.
| Compound Name | 3-methyl-2-(4-nitrophenoxy)-2-[[3-(4-nitrophenoxy)oxiran-2-yl]methyl]oxirane |
|---|---|
| PubChem CID | 87874185 |
| Molecular Formula | C18H16N2O8 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 3-methyl-2-(4-nitrophenoxy)-2-[[3-(4-nitrophenoxy)oxiran-2-yl]methyl]oxirane |
| SMILES | CC1OC1(CC1OC1Oc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H16N2O8/c1-11-18(27-11,28-15-8-4-13(5-9-15)20(23)24)10-16-17(26-16)25-14-6-2-12(3-7-14)19(21)22/h2-9,11,16-17H,10H2,1H3 |
| InChIKey | ZTJYQLWQTUITOO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 129.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|