C25H32F2O7S2 — CID 167531782
(2R,3R,4S,5R,6S)-2-ethyl-4-fluoro-6-phenylsulfanyloxane-3,5-diol;(2R,3R,4S,5R,6S)-4-fluoro-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,5-diol (PubChem CID 167531782) has the molecular formula C25H32F2O7S2 and a molecular weight of 546.65 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-ethyl-4-fluoro-6-phenylsulfanyloxane-3,5-diol;(2R,3R,4S,5R,6S)-4-fluoro-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,5-diol.
| Compound Name | (2R,3R,4S,5R,6S)-2-ethyl-4-fluoro-6-phenylsulfanyloxane-3,5-diol;(2R,3R,4S,5R,6S)-4-fluoro-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,5-diol |
|---|---|
| PubChem CID | 167531782 |
| Molecular Formula | C25H32F2O7S2 |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-ethyl-4-fluoro-6-phenylsulfanyloxane-3,5-diol;(2R,3R,4S,5R,6S)-4-fluoro-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,5-diol |
| SMILES | CC[C@H]1O[C@@H](Sc2ccccc2)[C@H](O)[C@@H](F)[C@@H]1O.OC[C@H]1O[C@@H](Sc2ccccc2)[C@H](O)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C13H17FO3S.C12H15FO4S/c1-2-9-11(15)10(14)12(16)13(17-9)18-8-6-4-3-5-7-8;13-9-10(15)8(6-14)17-12(11(9)16)18-7-4-2-1-3-5-7/h3-7,9-13,15-16H,2H2,1H3;1-5,8-12,14-16H,6H2/t9-,10+,11-,12-,13+;8-,9+,10-,11-,12+/m11/s1 |
| InChIKey | ABJKTAITWCKYKC-WSMLGZJESA-N |
| XLogP | 2.53 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |