C29H39N3O5 — CID 67923274
(E)-1-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethylamino]-3-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]prop-1-en-1-ol (PubChem CID 67923274) has the molecular formula C29H39N3O5 and a molecular weight of 509.65 g/mol. Its IUPAC name is (E)-1-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethylamino]-3-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]prop-1-en-1-ol.
| Compound Name | (E)-1-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethylamino]-3-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]prop-1-en-1-ol |
|---|---|
| PubChem CID | 67923274 |
| Molecular Formula | C29H39N3O5 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | (E)-1-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethylamino]-3-[3-methoxy-4-(2-methoxyethoxymethoxy)phenyl]prop-1-en-1-ol |
| SMILES | COCCOCOc1ccc(C/C=C(/O)NCCN2CCC(c3c[nH]c4ccccc34)CC2)cc1OC |
| InChI | InChI=1S/C29H39N3O5/c1-34-17-18-36-21-37-27-9-7-22(19-28(27)35-2)8-10-29(33)30-13-16-32-14-11-23(12-15-32)25-20-31-26-6-4-3-5-24(25)26/h3-7,9-10,19-20,23,30-31,33H,8,11-18,21H2,1-2H3/b29-10+ |
| InChIKey | TVCUDDYUFNEUEC-VYVUJPJFSA-N |
| XLogP | 4.59 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|