C32H36ClN3O4 — CID 154122262
N-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethyl]-5-(4-hydroxy-3,5-dimethoxyphenyl)penta-2,4-dienamide (PubChem CID 154122262) has the molecular formula C32H36ClN3O4 and a molecular weight of 562.11 g/mol. Its IUPAC name is N-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethyl]-5-(4-hydroxy-3,5-dimethoxyphenyl)penta-2,4-dienamide.
| Compound Name | N-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethyl]-5-(4-hydroxy-3,5-dimethoxyphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 154122262 |
| Molecular Formula | C32H36ClN3O4 |
| Molecular Weight | 562.11 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | N-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethyl]-5-(4-hydroxy-3,5-dimethoxyphenyl)penta-2,4-dienamide |
| SMILES | COc1cc(C=CC=CC(=O)NCCN2CCN(C(c3ccccc3)c3ccc(Cl)cc3)CC2)cc(OC)c1O |
| InChI | InChI=1S/C32H36ClN3O4/c1-39-28-22-24(23-29(40-2)32(28)38)8-6-7-11-30(37)34-16-17-35-18-20-36(21-19-35)31(25-9-4-3-5-10-25)26-12-14-27(33)15-13-26/h3-15,22-23,31,38H,16-21H2,1-2H3,(H,34,37) |
| InChIKey | DSRNHQNBJJUYDU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.11 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|