C25H27ClN4O — CID 127026232
N-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethyl]pyridine-4-carboxamide (PubChem CID 127026232) has the molecular formula C25H27ClN4O and a molecular weight of 434.97 g/mol. Its IUPAC name is N-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethyl]pyridine-4-carboxamide.
| Compound Name | N-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 127026232 |
| Molecular Formula | C25H27ClN4O |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | N-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethyl]pyridine-4-carboxamide |
| SMILES | O=C(NCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1)c1ccncc1 |
| InChI | InChI=1S/C25H27ClN4O/c26-23-8-6-21(7-9-23)24(20-4-2-1-3-5-20)30-18-16-29(17-19-30)15-14-28-25(31)22-10-12-27-13-11-22/h1-13,24H,14-19H2,(H,28,31) |
| InChIKey | VLBOFPCRAGJLSA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |