C26H30Cl2N4O — CID 45481124
(E)-3-(3,4-dichlorophenyl)-N-[5-[4-(2H-indazol-3-yl)piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 45481124) has the molecular formula C26H30Cl2N4O and a molecular weight of 485.46 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[4-(2H-indazol-3-yl)piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-(2H-indazol-3-yl)piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 45481124 |
| Molecular Formula | C26H30Cl2N4O |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-(2H-indazol-3-yl)piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCC(c2[nH]nc3ccccc23)CC1 |
| InChI | InChI=1S/C26H30Cl2N4O/c27-22-10-8-19(18-23(22)28)9-11-25(33)29-14-4-1-5-15-32-16-12-20(13-17-32)26-21-6-2-3-7-24(21)30-31-26/h2-3,6-11,18,20H,1,4-5,12-17H2,(H,29,33)(H,30,31)/b11-9+ |
| InChIKey | QCKAGLMQOMKLNL-PKNBQFBNSA-N |
| XLogP | 6.05 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|