C26H30Cl4N4O2 — CID 44529158
(E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3,5-dichlorophenyl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 44529158) has the molecular formula C26H30Cl4N4O2 and a molecular weight of 572.36 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3,5-dichlorophenyl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3,5-dichlorophenyl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44529158 |
| Molecular Formula | C26H30Cl4N4O2 |
| Molecular Weight | 572.36 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[(3,5-dichlorophenyl)carbamoylamino]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCC(NC(=O)Nc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C26H30Cl4N4O2/c27-19-15-20(28)17-22(16-19)33-26(36)32-21-8-12-34(13-9-21)11-3-1-2-10-31-25(35)7-5-18-4-6-23(29)24(30)14-18/h4-7,14-17,21H,1-3,8-13H2,(H,31,35)(H2,32,33,36)/b7-5+ |
| InChIKey | YABLTQUEFRNCNY-FNORWQNLSA-N |
| XLogP | 6.89 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.36 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|