C27H33Cl3N4O2 — CID 44529377
N-(3-chlorophenyl)-4-[6-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]hexyl]-1,4-diazepane-1-carboxamide (PubChem CID 44529377) has the molecular formula C27H33Cl3N4O2 and a molecular weight of 551.95 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[6-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]hexyl]-1,4-diazepane-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-4-[6-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]hexyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 44529377 |
| Molecular Formula | C27H33Cl3N4O2 |
| Molecular Weight | 551.95 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | N-(3-chlorophenyl)-4-[6-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]hexyl]-1,4-diazepane-1-carboxamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCCN1CCCN(C(=O)Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C27H33Cl3N4O2/c28-22-7-5-8-23(20-22)32-27(36)34-16-6-15-33(17-18-34)14-4-2-1-3-13-31-26(35)12-10-21-9-11-24(29)25(30)19-21/h5,7-12,19-20H,1-4,6,13-18H2,(H,31,35)(H,32,36)/b12-10+ |
| InChIKey | BWGRGZKEHVFBRB-ZRDIBKRKSA-N |
| XLogP | 6.58 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.95 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|