C25H29Cl2FN4O2 — CID 44529162
4-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]-N-(3-fluorophenyl)piperazine-1-carboxamide (PubChem CID 44529162) has the molecular formula C25H29Cl2FN4O2 and a molecular weight of 507.44 g/mol. Its IUPAC name is 4-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]-N-(3-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]-N-(3-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 44529162 |
| Molecular Formula | C25H29Cl2FN4O2 |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 4-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]-N-(3-fluorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCN(C(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C25H29Cl2FN4O2/c26-22-9-7-19(17-23(22)27)8-10-24(33)29-11-2-1-3-12-31-13-15-32(16-14-31)25(34)30-21-6-4-5-20(28)18-21/h4-10,17-18H,1-3,11-16H2,(H,29,33)(H,30,34)/b10-8+ |
| InChIKey | NUCSYJBDJZSVQV-CSKARUKUSA-N |
| XLogP | 5.28 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|