C19H30N4O2 — CID 124732893
N-[(2R)-2-[(2R)-2-methylpiperidin-1-yl]propyl]-2-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 124732893) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is N-[(2R)-2-[(2R)-2-methylpiperidin-1-yl]propyl]-2-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | N-[(2R)-2-[(2R)-2-methylpiperidin-1-yl]propyl]-2-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 124732893 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N-[(2R)-2-[(2R)-2-methylpiperidin-1-yl]propyl]-2-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | C[C@@H]1CCCCN1[C@H](C)CNC(=O)c1cccnc1N1CCOCC1 |
| InChI | InChI=1S/C19H30N4O2/c1-15-6-3-4-9-23(15)16(2)14-21-19(24)17-7-5-8-20-18(17)22-10-12-25-13-11-22/h5,7-8,15-16H,3-4,6,9-14H2,1-2H3,(H,21,24)/t15-,16-/m1/s1 |
| InChIKey | KAELVCMBLCSAMC-HZPDHXFCSA-N |
| XLogP | 1.91 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |