C25H29N3O4 — CID 56508671
2-(2,6-dimethylmorpholin-4-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-methylbutanamide (PubChem CID 56508671) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-methylbutanamide.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 56508671 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-3-methylbutanamide |
| SMILES | CC1CN(C(C(=O)Nc2cccc(N3C(=O)c4ccccc4C3=O)c2)C(C)C)CC(C)O1 |
| InChI | InChI=1S/C25H29N3O4/c1-15(2)22(27-13-16(3)32-17(4)14-27)23(29)26-18-8-7-9-19(12-18)28-24(30)20-10-5-6-11-21(20)25(28)31/h5-12,15-17,22H,13-14H2,1-4H3,(H,26,29) |
| InChIKey | YMSOJWYOHGCXGC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|