C16H20N2O3 — CID 111696877
N-[2-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]-2-oxoethyl]-N-methylbenzamide (PubChem CID 111696877) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-[2-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]-2-oxoethyl]-N-methylbenzamide.
| Compound Name | N-[2-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]-2-oxoethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111696877 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-[2-[[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]amino]-2-oxoethyl]-N-methylbenzamide |
| SMILES | CN(CC(=O)N[C@@H]1C=C[C@H](CO)C1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O3/c1-18(16(21)13-5-3-2-4-6-13)10-15(20)17-14-8-7-12(9-14)11-19/h2-8,12,14,19H,9-11H2,1H3,(H,17,20)/t12-,14+/m0/s1 |
| InChIKey | HWCXMEAYGCJEFD-GXTWGEPZSA-N |
| XLogP | 0.81 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|