C13H18N2O2S — CID 111697089
2-(2-ethyl-1,3-thiazol-4-yl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide (PubChem CID 111697089) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 2-(2-ethyl-1,3-thiazol-4-yl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide.
| Compound Name | 2-(2-ethyl-1,3-thiazol-4-yl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 111697089 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-(2-ethyl-1,3-thiazol-4-yl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide |
| SMILES | CCc1nc(CC(=O)N[C@@H]2C=C[C@H](CO)C2)cs1 |
| InChI | InChI=1S/C13H18N2O2S/c1-2-13-15-11(8-18-13)6-12(17)14-10-4-3-9(5-10)7-16/h3-4,8-10,16H,2,5-7H2,1H3,(H,14,17)/t9-,10+/m0/s1 |
| InChIKey | ISWNVKSJHDFIOW-VHSXEESVSA-N |
| XLogP | 1.30 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|