C16H20FNO2 — CID 111661196
3-(4-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]butanamide (PubChem CID 111661196) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]butanamide.
| Compound Name | 3-(4-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]butanamide |
|---|---|
| PubChem CID | 111661196 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]butanamide |
| SMILES | CC(CC(=O)N[C@@H]1C=C[C@H](CO)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H20FNO2/c1-11(13-3-5-14(17)6-4-13)8-16(20)18-15-7-2-12(9-15)10-19/h2-7,11-12,15,19H,8-10H2,1H3,(H,18,20)/t11?,12-,15+/m0/s1 |
| InChIKey | VNHFJYIXBFLGMV-WQKBPTQTSA-N |
| XLogP | 2.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|