C18H24N2O3 — CID 111661619
3-acetamido-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(4-methylphenyl)propanamide (PubChem CID 111661619) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-acetamido-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(4-methylphenyl)propanamide.
| Compound Name | 3-acetamido-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 111661619 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 3-acetamido-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(4-methylphenyl)propanamide |
| SMILES | CC(=O)NC(CC(=O)N[C@@H]1C=C[C@H](CO)C1)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H24N2O3/c1-12-3-6-15(7-4-12)17(19-13(2)22)10-18(23)20-16-8-5-14(9-16)11-21/h3-8,14,16-17,21H,9-11H2,1-2H3,(H,19,22)(H,20,23)/t14-,16+,17?/m0/s1 |
| InChIKey | KXKLTJOCUQRQHX-NOYLFRNESA-N |
| XLogP | 1.62 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|