C15H17Cl2NO3 — CID 111661613
2-(3,5-dichlorophenoxy)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanamide (PubChem CID 111661613) has the molecular formula C15H17Cl2NO3 and a molecular weight of 330.21 g/mol. Its IUPAC name is 2-(3,5-dichlorophenoxy)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanamide.
| Compound Name | 2-(3,5-dichlorophenoxy)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanamide |
|---|---|
| PubChem CID | 111661613 |
| Molecular Formula | C15H17Cl2NO3 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-(3,5-dichlorophenoxy)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]propanamide |
| SMILES | CC(Oc1cc(Cl)cc(Cl)c1)C(=O)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C15H17Cl2NO3/c1-9(21-14-6-11(16)5-12(17)7-14)15(20)18-13-3-2-10(4-13)8-19/h2-3,5-7,9-10,13,19H,4,8H2,1H3,(H,18,20)/t9?,10-,13+/m0/s1 |
| InChIKey | DZPYCCCIKONWNV-QQIFVLEESA-N |
| XLogP | 2.81 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|