C14H15Cl2NO3 — CID 111696926
2-(3,5-dichlorophenoxy)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide (PubChem CID 111696926) has the molecular formula C14H15Cl2NO3 and a molecular weight of 316.18 g/mol. Its IUPAC name is 2-(3,5-dichlorophenoxy)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide.
| Compound Name | 2-(3,5-dichlorophenoxy)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 111696926 |
| Molecular Formula | C14H15Cl2NO3 |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-(3,5-dichlorophenoxy)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]acetamide |
| SMILES | O=C(COc1cc(Cl)cc(Cl)c1)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C14H15Cl2NO3/c15-10-4-11(16)6-13(5-10)20-8-14(19)17-12-2-1-9(3-12)7-18/h1-2,4-6,9,12,18H,3,7-8H2,(H,17,19)/t9-,12+/m0/s1 |
| InChIKey | SZFJWGOANRHTOU-JOYOIKCWSA-N |
| XLogP | 2.43 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|