C19H18ClNO3 — CID 110000319
3-(4-chlorophenoxy)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]benzamide (PubChem CID 110000319) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is 3-(4-chlorophenoxy)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]benzamide.
| Compound Name | 3-(4-chlorophenoxy)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]benzamide |
|---|---|
| PubChem CID | 110000319 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-(4-chlorophenoxy)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]benzamide |
| SMILES | O=C(N[C@@H]1C=C[C@H](CO)C1)c1cccc(Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H18ClNO3/c20-15-5-8-17(9-6-15)24-18-3-1-2-14(11-18)19(23)21-16-7-4-13(10-16)12-22/h1-9,11,13,16,22H,10,12H2,(H,21,23)/t13-,16+/m0/s1 |
| InChIKey | GAZXZLRIUSHCNT-XJKSGUPXSA-N |
| XLogP | 3.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|