C20H18ClN3O2 — CID 162690764
3-(4-chlorophenoxy)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]benzamide (PubChem CID 162690764) has the molecular formula C20H18ClN3O2 and a molecular weight of 367.84 g/mol. Its IUPAC name is 3-(4-chlorophenoxy)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]benzamide.
| Compound Name | 3-(4-chlorophenoxy)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]benzamide |
|---|---|
| PubChem CID | 162690764 |
| Molecular Formula | C20H18ClN3O2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 3-(4-chlorophenoxy)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]benzamide |
| SMILES | N#CN1[C@H]2CC[C@@H]1[C@H](NC(=O)c1cccc(Oc3ccc(Cl)cc3)c1)C2 |
| InChI | InChI=1S/C20H18ClN3O2/c21-14-4-7-16(8-5-14)26-17-3-1-2-13(10-17)20(25)23-18-11-15-6-9-19(18)24(15)12-22/h1-5,7-8,10,15,18-19H,6,9,11H2,(H,23,25)/t15-,18+,19+/m0/s1 |
| InChIKey | KPUGPPFMGUWWPT-KFKAGJAMSA-N |
| XLogP | 3.95 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|