C15H15N3O3 — CID 166027513
phenyl 2-[[(2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]amino]-2-oxoacetate (PubChem CID 166027513) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is phenyl 2-[[(2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]amino]-2-oxoacetate.
| Compound Name | phenyl 2-[[(2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 166027513 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | phenyl 2-[[(2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]amino]-2-oxoacetate |
| SMILES | N#CN1C2CC[C@H]1C[C@H]2NC(=O)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C15H15N3O3/c16-9-18-10-6-7-13(18)12(8-10)17-14(19)15(20)21-11-4-2-1-3-5-11/h1-5,10,12-13H,6-8H2,(H,17,19)/t10-,12+,13?/m0/s1 |
| InChIKey | QBTUQINXNUXVPC-LQNXFFKNSA-N |
| XLogP | 0.79 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|