C12H19N3O2 — CID 162690713
tert-butyl N-[(1S,2S,4R)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]carbamate (PubChem CID 162690713) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S,4R)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S,4R)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]carbamate |
|---|---|
| PubChem CID | 162690713 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | tert-butyl N-[(1S,2S,4R)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H]2CC[C@@H]1N2C#N |
| InChI | InChI=1S/C12H19N3O2/c1-12(2,3)17-11(16)14-9-6-8-4-5-10(9)15(8)7-13/h8-10H,4-6H2,1-3H3,(H,14,16)/t8-,9+,10+/m1/s1 |
| InChIKey | HTQNRRAHGWOYPQ-UTLUCORTSA-N |
| XLogP | 1.60 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|