C13H20N2O — CID 163947106
N-(7-ethynyl-7-azabicyclo[2.2.1]heptan-2-yl)-2,2-dimethylpropanamide (PubChem CID 163947106) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N-(7-ethynyl-7-azabicyclo[2.2.1]heptan-2-yl)-2,2-dimethylpropanamide.
| Compound Name | N-(7-ethynyl-7-azabicyclo[2.2.1]heptan-2-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 163947106 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N-(7-ethynyl-7-azabicyclo[2.2.1]heptan-2-yl)-2,2-dimethylpropanamide |
| SMILES | C#CN1C2CCC1C(NC(=O)C(C)(C)C)C2 |
| InChI | InChI=1S/C13H20N2O/c1-5-15-9-6-7-11(15)10(8-9)14-12(16)13(2,3)4/h1,9-11H,6-8H2,2-4H3,(H,14,16) |
| InChIKey | MWGALPZBXTZJNB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|