C19H22Cl2N4O — CID 166027488
N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3,5-dichlorophenyl)-3-methylpyrrolidine-3-carboxamide (PubChem CID 166027488) has the molecular formula C19H22Cl2N4O and a molecular weight of 393.32 g/mol. Its IUPAC name is N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3,5-dichlorophenyl)-3-methylpyrrolidine-3-carboxamide.
| Compound Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3,5-dichlorophenyl)-3-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 166027488 |
| Molecular Formula | C19H22Cl2N4O |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3,5-dichlorophenyl)-3-methylpyrrolidine-3-carboxamide |
| SMILES | CC1(C(=O)N[C@@H]2C[C@@H]3CC[C@H]2N3C#N)CCN(c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C19H22Cl2N4O/c1-19(4-5-24(10-19)15-7-12(20)6-13(21)8-15)18(26)23-16-9-14-2-3-17(16)25(14)11-22/h6-8,14,16-17H,2-5,9-10H2,1H3,(H,23,26)/t14-,16+,17+,19?/m0/s1 |
| InChIKey | AZDHZEVVEPTOJC-DVSBVIQYSA-N |
| XLogP | 3.41 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|