C18H19Cl2FN4O — CID 162690895
(3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3,5-dichloro-4-fluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 162690895) has the molecular formula C18H19Cl2FN4O and a molecular weight of 397.28 g/mol. Its IUPAC name is (3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3,5-dichloro-4-fluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3,5-dichloro-4-fluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 162690895 |
| Molecular Formula | C18H19Cl2FN4O |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | (3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3,5-dichloro-4-fluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | N#CN1[C@H]2CC[C@@H]1[C@H](NC(=O)[C@H]1CCN(c3cc(Cl)c(F)c(Cl)c3)C1)C2 |
| InChI | InChI=1S/C18H19Cl2FN4O/c19-13-5-12(6-14(20)17(13)21)24-4-3-10(8-24)18(26)23-15-7-11-1-2-16(15)25(11)9-22/h5-6,10-11,15-16H,1-4,7-8H2,(H,23,26)/t10-,11-,15+,16+/m0/s1 |
| InChIKey | JDSSZYHZDPRDNC-DPDCMNJDSA-N |
| XLogP | 3.16 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|