C18H23N5O2 — CID 162690614
(3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(2-methoxy-4-pyridinyl)pyrrolidine-3-carboxamide (PubChem CID 162690614) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is (3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(2-methoxy-4-pyridinyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(2-methoxy-4-pyridinyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 162690614 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(2-methoxy-4-pyridinyl)pyrrolidine-3-carboxamide |
| SMILES | COc1cc(N2CC[C@H](C(=O)N[C@@H]3C[C@@H]4CC[C@H]3N4C#N)C2)ccn1 |
| InChI | InChI=1S/C18H23N5O2/c1-25-17-9-13(4-6-20-17)22-7-5-12(10-22)18(24)21-15-8-14-2-3-16(15)23(14)11-19/h4,6,9,12,14-16H,2-3,5,7-8,10H2,1H3,(H,21,24)/t12-,14-,15+,16+/m0/s1 |
| InChIKey | DONSFFDYAUORIM-ARLBYUKCSA-N |
| XLogP | 1.12 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|