C21H26N4O — CID 162690674
(3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3-cyclopropylphenyl)pyrrolidine-3-carboxamide (PubChem CID 162690674) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is (3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3-cyclopropylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3-cyclopropylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 162690674 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3-cyclopropylphenyl)pyrrolidine-3-carboxamide |
| SMILES | N#CN1[C@H]2CC[C@@H]1[C@H](NC(=O)[C@H]1CCN(c3cccc(C4CC4)c3)C1)C2 |
| InChI | InChI=1S/C21H26N4O/c22-13-25-18-6-7-20(25)19(11-18)23-21(26)16-8-9-24(12-16)17-3-1-2-15(10-17)14-4-5-14/h1-3,10,14,16,18-20H,4-9,11-12H2,(H,23,26)/t16-,18-,19+,20+/m0/s1 |
| InChIKey | FUVMTCMLINGEOQ-IJXRJRJASA-N |
| XLogP | 2.59 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|