C18H20Cl2N4O — CID 162690770
(3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3,5-dichlorophenyl)pyrrolidine-3-carboxamide (PubChem CID 162690770) has the molecular formula C18H20Cl2N4O and a molecular weight of 379.29 g/mol. Its IUPAC name is (3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3,5-dichlorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3,5-dichlorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 162690770 |
| Molecular Formula | C18H20Cl2N4O |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | (3S)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-(3,5-dichlorophenyl)pyrrolidine-3-carboxamide |
| SMILES | N#CN1[C@H]2CC[C@@H]1[C@H](NC(=O)[C@H]1CCN(c3cc(Cl)cc(Cl)c3)C1)C2 |
| InChI | InChI=1S/C18H20Cl2N4O/c19-12-5-13(20)7-15(6-12)23-4-3-11(9-23)18(25)22-16-8-14-1-2-17(16)24(14)10-21/h5-7,11,14,16-17H,1-4,8-9H2,(H,22,25)/t11-,14-,16+,17+/m0/s1 |
| InChIKey | UMBNBTXRIPFLPQ-HYEYJGRESA-N |
| XLogP | 3.02 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|