C19H21ClN4O — CID 162690985
(1R,5R)-3-(3-chlorophenyl)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-azabicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 162690985) has the molecular formula C19H21ClN4O and a molecular weight of 356.86 g/mol. Its IUPAC name is (1R,5R)-3-(3-chlorophenyl)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-azabicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1R,5R)-3-(3-chlorophenyl)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-azabicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 162690985 |
| Molecular Formula | C19H21ClN4O |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (1R,5R)-3-(3-chlorophenyl)-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-azabicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | N#CN1[C@H]2CC[C@@H]1[C@H](NC(=O)[C@]13C[C@H]1CN(c1cccc(Cl)c1)C3)C2 |
| InChI | InChI=1S/C19H21ClN4O/c20-13-2-1-3-14(6-13)23-9-12-8-19(12,10-23)18(25)22-16-7-15-4-5-17(16)24(15)11-21/h1-3,6,12,15-17H,4-5,7-10H2,(H,22,25)/t12-,15-,16+,17+,19-/m0/s1 |
| InChIKey | BDXDUPXVFJPEIS-VMRMDKAQSA-N |
| XLogP | 2.37 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|