C16H15ClF3N3O2 — CID 167844904
2-[4-chloro-3-(trifluoromethyl)phenoxy]-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]acetamide (PubChem CID 167844904) has the molecular formula C16H15ClF3N3O2 and a molecular weight of 373.76 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)phenoxy]-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]acetamide.
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)phenoxy]-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]acetamide |
|---|---|
| PubChem CID | 167844904 |
| Molecular Formula | C16H15ClF3N3O2 |
| Molecular Weight | 373.76 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)phenoxy]-N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]acetamide |
| SMILES | N#CN1[C@H]2CC[C@@H]1[C@H](NC(=O)COc1ccc(Cl)c(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C16H15ClF3N3O2/c17-12-3-2-10(6-11(12)16(18,19)20)25-7-15(24)22-13-5-9-1-4-14(13)23(9)8-21/h2-3,6,9,13-14H,1,4-5,7H2,(H,22,24)/t9-,13+,14+/m0/s1 |
| InChIKey | JYVWPXCJAHNRTC-CUOATXAZSA-N |
| XLogP | 2.94 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.76 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|