C17H16ClF3N2O2 — CID 167543309
1-[4-chloro-3-(trifluoromethyl)phenoxy]-3-(7-isocyano-7-azabicyclo[2.2.1]heptan-2-yl)propan-2-one (PubChem CID 167543309) has the molecular formula C17H16ClF3N2O2 and a molecular weight of 372.77 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenoxy]-3-(7-isocyano-7-azabicyclo[2.2.1]heptan-2-yl)propan-2-one.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenoxy]-3-(7-isocyano-7-azabicyclo[2.2.1]heptan-2-yl)propan-2-one |
|---|---|
| PubChem CID | 167543309 |
| Molecular Formula | C17H16ClF3N2O2 |
| Molecular Weight | 372.77 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenoxy]-3-(7-isocyano-7-azabicyclo[2.2.1]heptan-2-yl)propan-2-one |
| SMILES | [C-]#[N+]N1C2CCC1C(CC(=O)COc1ccc(Cl)c(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C17H16ClF3N2O2/c1-22-23-11-2-5-16(23)10(6-11)7-12(24)9-25-13-3-4-15(18)14(8-13)17(19,20)21/h3-4,8,10-11,16H,2,5-7,9H2 |
| InChIKey | ZTUSGLOKGCXTJH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 33.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.77 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|