C16H18Cl2N4O — CID 166027575
1-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-[1-(2,3-dichlorophenyl)ethyl]urea (PubChem CID 166027575) has the molecular formula C16H18Cl2N4O and a molecular weight of 353.25 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-[1-(2,3-dichlorophenyl)ethyl]urea.
| Compound Name | 1-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-[1-(2,3-dichlorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 166027575 |
| Molecular Formula | C16H18Cl2N4O |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 1-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-[1-(2,3-dichlorophenyl)ethyl]urea |
| SMILES | CC(NC(=O)N[C@@H]1C[C@@H]2CC[C@H]1N2C#N)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H18Cl2N4O/c1-9(11-3-2-4-12(17)15(11)18)20-16(23)21-13-7-10-5-6-14(13)22(10)8-19/h2-4,9-10,13-14H,5-7H2,1H3,(H2,20,21,23)/t9?,10-,13+,14+/m0/s1 |
| InChIKey | DWCCGDVVNYWQLX-WHTLWQDESA-N |
| XLogP | 3.44 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|