C11H14Cl2N4O — CID 134068685
N-[1-(2,3-dichlorophenyl)ethyl]triazolidine-4-carboxamide (PubChem CID 134068685) has the molecular formula C11H14Cl2N4O and a molecular weight of 289.17 g/mol. Its IUPAC name is N-[1-(2,3-dichlorophenyl)ethyl]triazolidine-4-carboxamide.
| Compound Name | N-[1-(2,3-dichlorophenyl)ethyl]triazolidine-4-carboxamide |
|---|---|
| PubChem CID | 134068685 |
| Molecular Formula | C11H14Cl2N4O |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | N-[1-(2,3-dichlorophenyl)ethyl]triazolidine-4-carboxamide |
| SMILES | CC(NC(=O)C1CNNN1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H14Cl2N4O/c1-6(7-3-2-4-8(12)10(7)13)15-11(18)9-5-14-17-16-9/h2-4,6,9,14,16-17H,5H2,1H3,(H,15,18) |
| InChIKey | PRYJPJAYKSHAEW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |