C14H18Cl2N2O2 — CID 120933721
(2R,3S)-N-[1-(2,3-dichlorophenyl)ethyl]-2-methylmorpholine-3-carboxamide (PubChem CID 120933721) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is (2R,3S)-N-[1-(2,3-dichlorophenyl)ethyl]-2-methylmorpholine-3-carboxamide.
| Compound Name | (2R,3S)-N-[1-(2,3-dichlorophenyl)ethyl]-2-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 120933721 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (2R,3S)-N-[1-(2,3-dichlorophenyl)ethyl]-2-methylmorpholine-3-carboxamide |
| SMILES | CC(NC(=O)[C@H]1NCCO[C@@H]1C)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-8(10-4-3-5-11(15)12(10)16)18-14(19)13-9(2)20-7-6-17-13/h3-5,8-9,13,17H,6-7H2,1-2H3,(H,18,19)/t8?,9-,13+/m1/s1 |
| InChIKey | XDXKHYMMNLMAGC-OASAKOPFSA-N |
| XLogP | 2.55 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |