C17H22N4O2 — CID 120933166
(2R,3S)-2-methyl-N-[1-(3-pyrazol-1-ylphenyl)ethyl]morpholine-3-carboxamide (PubChem CID 120933166) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is (2R,3S)-2-methyl-N-[1-(3-pyrazol-1-ylphenyl)ethyl]morpholine-3-carboxamide.
| Compound Name | (2R,3S)-2-methyl-N-[1-(3-pyrazol-1-ylphenyl)ethyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 120933166 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (2R,3S)-2-methyl-N-[1-(3-pyrazol-1-ylphenyl)ethyl]morpholine-3-carboxamide |
| SMILES | CC(NC(=O)[C@H]1NCCO[C@@H]1C)c1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C17H22N4O2/c1-12(20-17(22)16-13(2)23-10-8-18-16)14-5-3-6-15(11-14)21-9-4-7-19-21/h3-7,9,11-13,16,18H,8,10H2,1-2H3,(H,20,22)/t12?,13-,16+/m1/s1 |
| InChIKey | QQGKESWEUAZHST-QVNUIZJESA-N |
| XLogP | 1.43 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |