C12H17ClN4O2 — CID 134068515
N-[2-(3-chlorophenyl)-2-methoxyethyl]triazolidine-4-carboxamide (PubChem CID 134068515) has the molecular formula C12H17ClN4O2 and a molecular weight of 284.75 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-2-methoxyethyl]triazolidine-4-carboxamide.
| Compound Name | N-[2-(3-chlorophenyl)-2-methoxyethyl]triazolidine-4-carboxamide |
|---|---|
| PubChem CID | 134068515 |
| Molecular Formula | C12H17ClN4O2 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-[2-(3-chlorophenyl)-2-methoxyethyl]triazolidine-4-carboxamide |
| SMILES | COC(CNC(=O)C1CNNN1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H17ClN4O2/c1-19-11(8-3-2-4-9(13)5-8)7-14-12(18)10-6-15-17-16-10/h2-5,10-11,15-17H,6-7H2,1H3,(H,14,18) |
| InChIKey | HYMUVZFRSOYPKJ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |