C15H21ClN2O3 — CID 96566001
1-[(2R)-2-(3-chlorophenyl)-2-methoxyethyl]-3-[(1-hydroxycyclobutyl)methyl]urea (PubChem CID 96566001) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 1-[(2R)-2-(3-chlorophenyl)-2-methoxyethyl]-3-[(1-hydroxycyclobutyl)methyl]urea.
| Compound Name | 1-[(2R)-2-(3-chlorophenyl)-2-methoxyethyl]-3-[(1-hydroxycyclobutyl)methyl]urea |
|---|---|
| PubChem CID | 96566001 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-[(2R)-2-(3-chlorophenyl)-2-methoxyethyl]-3-[(1-hydroxycyclobutyl)methyl]urea |
| SMILES | CO[C@@H](CNC(=O)NCC1(O)CCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-21-13(11-4-2-5-12(16)8-11)9-17-14(19)18-10-15(20)6-3-7-15/h2,4-5,8,13,20H,3,6-7,9-10H2,1H3,(H2,17,18,19)/t13-/m0/s1 |
| InChIKey | BOJPOSDQVYDGPG-ZDUSSCGKSA-N |
| XLogP | 2.24 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |